C19H19N5O4S — CID 133487122
methyl 3-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4-nitrobenzoate (PubChem CID 133487122) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is methyl 3-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4-nitrobenzoate.
| Compound Name | methyl 3-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4-nitrobenzoate |
|---|---|
| PubChem CID | 133487122 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 3-[4-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(N2CCN(c3ncnc4sc(C)cc34)CC2)c1 |
| InChI | InChI=1S/C19H19N5O4S/c1-12-9-14-17(20-11-21-18(14)29-12)23-7-5-22(6-8-23)16-10-13(19(25)28-2)3-4-15(16)24(26)27/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | JLYUUXYQJYGTAT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|