C18H15BrF3N5O2 — CID 55456964
3-[1-(4-bromo-2-nitrophenyl)piperidin-3-yl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 55456964) has the molecular formula C18H15BrF3N5O2 and a molecular weight of 470.25 g/mol. Its IUPAC name is 3-[1-(4-bromo-2-nitrophenyl)piperidin-3-yl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[1-(4-bromo-2-nitrophenyl)piperidin-3-yl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 55456964 |
| Molecular Formula | C18H15BrF3N5O2 |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 3-[1-(4-bromo-2-nitrophenyl)piperidin-3-yl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1N1CCCC(c2nnc3ccc(C(F)(F)F)cn23)C1 |
| InChI | InChI=1S/C18H15BrF3N5O2/c19-13-4-5-14(15(8-13)27(28)29)25-7-1-2-11(9-25)17-24-23-16-6-3-12(10-26(16)17)18(20,21)22/h3-6,8,10-11H,1-2,7,9H2 |
| InChIKey | CPEOYSRJWQBKOR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|