C26H34N4O2S — CID 108729711
1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione (PubChem CID 108729711) has the molecular formula C26H34N4O2S and a molecular weight of 466.65 g/mol. Its IUPAC name is 1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione.
| Compound Name | 1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 108729711 |
| Molecular Formula | C26H34N4O2S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCN(c2nnc(C3CCCCC3)s2)CC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H34N4O2S/c31-23(22-11-10-19-6-4-5-9-21(19)18-22)12-13-24(32)29-14-16-30(17-15-29)26-28-27-25(33-26)20-7-2-1-3-8-20/h10-11,18,20H,1-9,12-17H2 |
| InChIKey | ODPRHUKTRVYFKI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |