C19H25ClN4O2S — CID 108753347
4-(4-chloro-3,5-dimethylphenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 108753347) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108753347 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | Cc1nnc(N2CCN(C(=O)CCCOc3cc(C)c(Cl)c(C)c3)CC2)s1 |
| InChI | InChI=1S/C19H25ClN4O2S/c1-13-11-16(12-14(2)18(13)20)26-10-4-5-17(25)23-6-8-24(9-7-23)19-22-21-15(3)27-19/h11-12H,4-10H2,1-3H3 |
| InChIKey | PMOKQADGSXDJEY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|