C12H20N4O2S — CID 108729541
butyl 4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazine-1-carboxylate (PubChem CID 108729541) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is butyl 4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazine-1-carboxylate.
| Compound Name | butyl 4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108729541 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | butyl 4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(c2nnc(C)s2)CC1 |
| InChI | InChI=1S/C12H20N4O2S/c1-3-4-9-18-12(17)16-7-5-15(6-8-16)11-14-13-10(2)19-11/h3-9H2,1-2H3 |
| InChIKey | ZDBPZYUUEFNBTH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|