C24H26N3O4+ — CID 9022254
N-(2-ethylphenyl)-2-[4-(2-oxochromene-3-carbonyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9022254) has the molecular formula C24H26N3O4+ and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-(2-oxochromene-3-carbonyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-(2-oxochromene-3-carbonyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9022254 |
| Molecular Formula | C24H26N3O4+ |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-(2-oxochromene-3-carbonyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=O)c2cc3ccccc3oc2=O)CC1 |
| InChI | InChI=1S/C24H25N3O4/c1-2-17-7-3-5-9-20(17)25-22(28)16-26-11-13-27(14-12-26)23(29)19-15-18-8-4-6-10-21(18)31-24(19)30/h3-10,15H,2,11-14,16H2,1H3,(H,25,28)/p+1 |
| InChIKey | DFVIWWBADCWBDS-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|