C26H33N3O4 — CID 58707801
1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 58707801) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 58707801 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc(C(=O)N3CC[C@H]4CCCC[C@H]4C3)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-32-22-10-7-18(8-11-22)16-27-26(31)28-21-9-12-23(24(15-21)33-2)25(30)29-14-13-19-5-3-4-6-20(19)17-29/h7-12,15,19-20H,3-6,13-14,16-17H2,1-2H3,(H2,27,28,31)/t19-,20+/m1/s1 |
| InChIKey | NGJIQOXDTLQPAO-UXHICEINSA-N |
| XLogP | 4.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |