C18H26N2OS — CID 8724716
(4aR,8aR)-N-[(4-methoxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide (PubChem CID 8724716) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is (4aR,8aR)-N-[(4-methoxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (4aR,8aR)-N-[(4-methoxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 8724716 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4aR,8aR)-N-[(4-methoxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1ccc(CNC(=S)N2CC[C@H]3CCCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H26N2OS/c1-21-17-8-6-14(7-9-17)12-19-18(22)20-11-10-15-4-2-3-5-16(15)13-20/h6-9,15-16H,2-5,10-13H2,1H3,(H,19,22)/t15-,16+/m1/s1 |
| InChIKey | SFXADJGDTPRMIF-CVEARBPZSA-N |
| XLogP | 3.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|