C23H32N2O4 — CID 58707781
cyclopentyl N-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]carbamate (PubChem CID 58707781) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is cyclopentyl N-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]carbamate.
| Compound Name | cyclopentyl N-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 58707781 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | cyclopentyl N-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]carbamate |
| SMILES | COc1cc(NC(=O)OC2CCCC2)ccc1C(=O)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C23H32N2O4/c1-28-21-14-18(24-23(27)29-19-8-4-5-9-19)10-11-20(21)22(26)25-13-12-16-6-2-3-7-17(16)15-25/h10-11,14,16-17,19H,2-9,12-13,15H2,1H3,(H,24,27)/t16-,17+/m1/s1 |
| InChIKey | UTICRCKBQDYQQC-SJORKVTESA-N |
| XLogP | 4.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |