C15H19NO5 — CID 139715310
methyl 4-(cyclohexyloxycarbonylamino)-2-hydroxybenzoate (PubChem CID 139715310) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl 4-(cyclohexyloxycarbonylamino)-2-hydroxybenzoate.
| Compound Name | methyl 4-(cyclohexyloxycarbonylamino)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 139715310 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl 4-(cyclohexyloxycarbonylamino)-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)OC2CCCCC2)cc1O |
| InChI | InChI=1S/C15H19NO5/c1-20-14(18)12-8-7-10(9-13(12)17)16-15(19)21-11-5-3-2-4-6-11/h7-9,11,17H,2-6H2,1H3,(H,16,19) |
| InChIKey | YLUWSVMVLXMJHE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |