C23H32ClN3O2 — CID 58707624
1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-chlorophenyl]-3-cyclohexylurea (PubChem CID 58707624) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-chlorophenyl]-3-cyclohexylurea.
| Compound Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-chlorophenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 58707624 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-chlorophenyl]-3-cyclohexylurea |
| SMILES | O=C(Nc1ccc(C(=O)N2CC[C@H]3CCCC[C@H]3C2)c(Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C23H32ClN3O2/c24-21-14-19(26-23(29)25-18-8-2-1-3-9-18)10-11-20(21)22(28)27-13-12-16-6-4-5-7-17(16)15-27/h10-11,14,16-18H,1-9,12-13,15H2,(H2,25,26,29)/t16-,17+/m1/s1 |
| InChIKey | BNUVGNGNRQQINI-SJORKVTESA-N |
| XLogP | 5.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |