C21H31N3O3 — CID 92729966
(2S)-N-butyl-1-[4-(2,2-dimethylpropanoylamino)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 92729966) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (2S)-N-butyl-1-[4-(2,2-dimethylpropanoylamino)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-butyl-1-[4-(2,2-dimethylpropanoylamino)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92729966 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (2S)-N-butyl-1-[4-(2,2-dimethylpropanoylamino)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN1C(=O)c1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H31N3O3/c1-5-6-13-22-18(25)17-8-7-14-24(17)19(26)15-9-11-16(12-10-15)23-20(27)21(2,3)4/h9-12,17H,5-8,13-14H2,1-4H3,(H,22,25)(H,23,27)/t17-/m0/s1 |
| InChIKey | GLJZENJZZIWSQV-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|