C24H36N4OS — CID 58708187
1-[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-(2-piperidin-1-ylethyl)thiourea (PubChem CID 58708187) has the molecular formula C24H36N4OS and a molecular weight of 428.65 g/mol. Its IUPAC name is 1-[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-(2-piperidin-1-ylethyl)thiourea.
| Compound Name | 1-[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-(2-piperidin-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 58708187 |
| Molecular Formula | C24H36N4OS |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 1-[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-(2-piperidin-1-ylethyl)thiourea |
| SMILES | O=C(c1ccc(NC(=S)NCCN2CCCCC2)cc1)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H36N4OS/c29-23(28-17-6-8-19-7-2-3-9-22(19)28)20-10-12-21(13-11-20)26-24(30)25-14-18-27-15-4-1-5-16-27/h10-13,19,22H,1-9,14-18H2,(H2,25,26,30)/t19-,22-/m0/s1 |
| InChIKey | VYTBTOQIFSGRME-UGKGYDQZSA-N |
| XLogP | 4.25 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|