C23H27N3O4S — CID 11539479
N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-sulfamoylbenzamide (PubChem CID 11539479) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-sulfamoylbenzamide.
| Compound Name | N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 11539479 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)Nc2ccc(C(=O)N3CCC[C@H]4CCCC[C@@H]43)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c24-31(29,30)20-13-9-17(10-14-20)22(27)25-19-11-7-18(8-12-19)23(28)26-15-3-5-16-4-1-2-6-21(16)26/h7-14,16,21H,1-6,15H2,(H,25,27)(H2,24,29,30)/t16-,21+/m1/s1 |
| InChIKey | GWBYYDXVFSGREM-IERDGZPVSA-N |
| XLogP | 3.38 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |