C24H29ClN2O2 — CID 142924998
N-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-chloro-3-methylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 142924998) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is N-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-chloro-3-methylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-chloro-3-methylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 142924998 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-4-chloro-3-methylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1C=C(C(=O)Nc2ccc(C(=O)N3CCC[C@H]4CCCCC43)cc2)C=CC1Cl |
| InChI | InChI=1S/C24H29ClN2O2/c1-16-15-19(10-13-21(16)25)23(28)26-20-11-8-18(9-12-20)24(29)27-14-4-6-17-5-2-3-7-22(17)27/h8-13,15-17,21-22H,2-7,14H2,1H3,(H,26,28)/t16?,17-,21?,22?/m1/s1 |
| InChIKey | UHRZWJPDVMHTKT-ROLIJVLMSA-N |
| XLogP | 5.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|