C28H31FN2O2 — CID 142924968
N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)phenyl]-4-fluoro-6-methyl-5,6-dihydronaphthalene-1-carboxamide (PubChem CID 142924968) has the molecular formula C28H31FN2O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)phenyl]-4-fluoro-6-methyl-5,6-dihydronaphthalene-1-carboxamide.
| Compound Name | N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)phenyl]-4-fluoro-6-methyl-5,6-dihydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 142924968 |
| Molecular Formula | C28H31FN2O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)phenyl]-4-fluoro-6-methyl-5,6-dihydronaphthalene-1-carboxamide |
| SMILES | CC1C=Cc2c(C(=O)Nc3ccc(C(=O)N4CCCC5CCCCC54)cc3)ccc(F)c2C1 |
| InChI | InChI=1S/C28H31FN2O2/c1-18-8-13-22-23(14-15-25(29)24(22)17-18)27(32)30-21-11-9-20(10-12-21)28(33)31-16-4-6-19-5-2-3-7-26(19)31/h8-15,18-19,26H,2-7,16-17H2,1H3,(H,30,32) |
| InChIKey | HMWDLOVEVZDNMZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |