C31H40N2O2 — CID 58708097
[5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindol-1-yl]-(4-hexylphenyl)methanone (PubChem CID 58708097) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is [5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindol-1-yl]-(4-hexylphenyl)methanone.
| Compound Name | [5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindol-1-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 58708097 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | [5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindol-1-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCc3cc(C(=O)N4CCC[C@H]5CCCC[C@H]54)ccc32)cc1 |
| InChI | InChI=1S/C31H40N2O2/c1-2-3-4-5-9-23-13-15-25(16-14-23)30(34)33-21-19-26-22-27(17-18-29(26)33)31(35)32-20-8-11-24-10-6-7-12-28(24)32/h13-18,22,24,28H,2-12,19-21H2,1H3/t24-,28-/m1/s1 |
| InChIKey | MTBQMCRBQYCOKK-UFHPHHKVSA-N |
| XLogP | 6.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|