C22H30N2O4 — CID 58707677
2-methoxyethyl 5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 58707677) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-methoxyethyl 5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | 2-methoxyethyl 5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 58707677 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-methoxyethyl 5-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | COCCOC(=O)N1CCc2cc(C(=O)N3CCC[C@H]4CCCC[C@H]43)ccc21 |
| InChI | InChI=1S/C22H30N2O4/c1-27-13-14-28-22(26)24-12-10-17-15-18(8-9-20(17)24)21(25)23-11-4-6-16-5-2-3-7-19(16)23/h8-9,15-16,19H,2-7,10-14H2,1H3/t16-,19-/m1/s1 |
| InChIKey | NGQMLQRYIRIEOH-VQIMIIECSA-N |
| XLogP | 3.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|