C14H17ClN2O4S2 — CID 70714627
1-[(4aR,7aS)-4-(3-chlorothiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one (PubChem CID 70714627) has the molecular formula C14H17ClN2O4S2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(3-chlorothiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-(3-chlorothiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70714627 |
| Molecular Formula | C14H17ClN2O4S2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-[(4aR,7aS)-4-(3-chlorothiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)c2sccc2Cl)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C14H17ClN2O4S2/c1-2-12(18)16-4-5-17(11-8-23(20,21)7-10(11)16)14(19)13-9(15)3-6-22-13/h3,6,10-11H,2,4-5,7-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | MBNFGWJMWNNNCI-MNOVXSKESA-N |
| XLogP | 1.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |