C20H28N2O4S — CID 133120896
1-[(4aS,7aR)-4-(3,5-dimethylbenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one (PubChem CID 133120896) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-[(4aS,7aR)-4-(3,5-dimethylbenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(4aS,7aR)-4-(3,5-dimethylbenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 133120896 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[(4aS,7aR)-4-(3,5-dimethylbenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one |
| SMILES | Cc1cc(C)cc(C(=O)N2CCN(C(=O)CC(C)C)[C@H]3CS(=O)(=O)C[C@H]32)c1 |
| InChI | InChI=1S/C20H28N2O4S/c1-13(2)7-19(23)21-5-6-22(18-12-27(25,26)11-17(18)21)20(24)16-9-14(3)8-15(4)10-16/h8-10,13,17-18H,5-7,11-12H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | XOXKEJGHELHSKB-ZWKOTPCHSA-N |
| XLogP | 1.80 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |