C15H20N2O5S — CID 133118481
1-[(4aR,7aS)-1-(furan-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one (PubChem CID 133118481) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-(furan-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-(furan-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 133118481 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-[(4aR,7aS)-1-(furan-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(C(=O)c2ccoc2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H20N2O5S/c1-10(2)14(18)16-4-5-17(15(19)11-3-6-22-7-11)13-9-23(20,21)8-12(13)16/h3,6-7,10,12-13H,4-5,8-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | YSVZRKFLKIYQGI-QWHCGFSZSA-N |
| XLogP | 0.39 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |