C16H28N2O5S — CID 124896372
tert-butyl (4aS,7aR)-1-(3-methylbutanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate (PubChem CID 124896372) has the molecular formula C16H28N2O5S and a molecular weight of 360.48 g/mol. Its IUPAC name is tert-butyl (4aS,7aR)-1-(3-methylbutanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate.
| Compound Name | tert-butyl (4aS,7aR)-1-(3-methylbutanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 124896372 |
| Molecular Formula | C16H28N2O5S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl (4aS,7aR)-1-(3-methylbutanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)OC(C)(C)C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H28N2O5S/c1-11(2)8-14(19)17-6-7-18(15(20)23-16(3,4)5)13-10-24(21,22)9-12(13)17/h11-13H,6-10H2,1-5H3/t12-,13+/m0/s1 |
| InChIKey | QSHBKEFKJKTXBU-QWHCGFSZSA-N |
| XLogP | 1.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |