C16H26N2O5S — CID 132899431
tert-butyl 1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate (PubChem CID 132899431) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is tert-butyl 1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate.
| Compound Name | tert-butyl 1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 132899431 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | tert-butyl 1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C2CCC2)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C16H26N2O5S/c1-16(2,3)23-15(20)18-8-7-17(14(19)11-5-4-6-11)12-9-24(21,22)10-13(12)18/h11-13H,4-10H2,1-3H3 |
| InChIKey | QZIYFZPQZBFGJE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |