C15H20N4O5S — CID 70773521
1-[(4aR,7aS)-4-(3-acetyl-1H-pyrazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one (PubChem CID 70773521) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(3-acetyl-1H-pyrazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-(3-acetyl-1H-pyrazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70773521 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-[(4aR,7aS)-4-(3-acetyl-1H-pyrazole-5-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)c2cc(C(C)=O)n[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H20N4O5S/c1-3-14(21)18-4-5-19(13-8-25(23,24)7-12(13)18)15(22)11-6-10(9(2)20)16-17-11/h6,12-13H,3-5,7-8H2,1-2H3,(H,16,17)/t12-,13+/m1/s1 |
| InChIKey | AWLWCBSTNJEHMW-OLZOCXBDSA-N |
| XLogP | -0.53 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |