C18H27N3O4S — CID 70723826
(4aR,7aS)-1-(2-methoxyethyl)-N-[(2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70723826) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is (4aR,7aS)-1-(2-methoxyethyl)-N-[(2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aR,7aS)-1-(2-methoxyethyl)-N-[(2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70723826 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (4aR,7aS)-1-(2-methoxyethyl)-N-[(2-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | COCCN1CCN(C(=O)NCc2ccccc2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H27N3O4S/c1-14-5-3-4-6-15(14)11-19-18(22)21-8-7-20(9-10-25-2)16-12-26(23,24)13-17(16)21/h3-6,16-17H,7-13H2,1-2H3,(H,19,22)/t16-,17+/m1/s1 |
| InChIKey | URFILDZNXWWSGT-SJORKVTESA-N |
| XLogP | 0.63 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |