C16H29N3O5S — CID 133118358
2-[(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone (PubChem CID 133118358) has the molecular formula C16H29N3O5S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone.
| Compound Name | 2-[(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 133118358 |
| Molecular Formula | C16H29N3O5S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)CN2CCN(CCO)[C@H]3CS(=O)(=O)C[C@H]32)C[C@H](C)O1 |
| InChI | InChI=1S/C16H29N3O5S/c1-12-7-19(8-13(2)24-12)16(21)9-18-4-3-17(5-6-20)14-10-25(22,23)11-15(14)18/h12-15,20H,3-11H2,1-2H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | YSSLHOQTXYMQBF-LJISPDSOSA-N |
| XLogP | -1.60 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |