C15H28N4O4S — CID 133135161
(4aS,7aR)-1-[2-(dimethylamino)-2-oxoethyl]-N,N-diethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 133135161) has the molecular formula C15H28N4O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is (4aS,7aR)-1-[2-(dimethylamino)-2-oxoethyl]-N,N-diethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-1-[2-(dimethylamino)-2-oxoethyl]-N,N-diethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 133135161 |
| Molecular Formula | C15H28N4O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (4aS,7aR)-1-[2-(dimethylamino)-2-oxoethyl]-N,N-diethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(CC(=O)N(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H28N4O4S/c1-5-17(6-2)15(21)19-8-7-18(9-14(20)16(3)4)12-10-24(22,23)11-13(12)19/h12-13H,5-11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | UFLZRBHDXWUWJQ-QWHCGFSZSA-N |
| XLogP | -0.68 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |