C16H26N4O4S — CID 133116192
2-[(4aR,7aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide (PubChem CID 133116192) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[(4aR,7aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aR,7aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 133116192 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[(4aR,7aS)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
| SMILES | Cc1noc(C)c1CN1CCN(CC(=O)N(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H26N4O4S/c1-11-13(12(2)24-17-11)7-19-5-6-20(8-16(21)18(3)4)15-10-25(22,23)9-14(15)19/h14-15H,5-10H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | HBPSIVSGLWVIQB-CABCVRRESA-N |
| XLogP | -0.34 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |