C15H24ClN5O3S — CID 70781834
2-[(4aS,7aR)-1-[2-(4-chloropyrazol-1-yl)ethyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide (PubChem CID 70781834) has the molecular formula C15H24ClN5O3S and a molecular weight of 389.91 g/mol. Its IUPAC name is 2-[(4aS,7aR)-1-[2-(4-chloropyrazol-1-yl)ethyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aS,7aR)-1-[2-(4-chloropyrazol-1-yl)ethyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 70781834 |
| Molecular Formula | C15H24ClN5O3S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[(4aS,7aR)-1-[2-(4-chloropyrazol-1-yl)ethyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCn2cc(Cl)cn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H24ClN5O3S/c1-18(2)15(22)9-20-4-3-19(5-6-21-8-12(16)7-17-21)13-10-25(23,24)11-14(13)20/h7-8,13-14H,3-6,9-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | COGHTWMNTHGRBX-UONOGXRCSA-N |
| XLogP | -0.59 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |