C16H21N5O3S — CID 70706114
(4aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70706114) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is (4aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70706114 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (4aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1noc(C)c1CN1CCN(c2ncccn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H21N5O3S/c1-11-13(12(2)24-19-11)8-20-6-7-21(16-17-4-3-5-18-16)15-10-25(22,23)9-14(15)20/h3-5,14-15H,6-10H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | KSVRDGZZIWSGEH-LSDHHAIUSA-N |
| XLogP | 0.57 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |