C17H25N5O3S — CID 70761260
1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-piperidin-1-ylethanone (PubChem CID 70761260) has the molecular formula C17H25N5O3S and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-piperidin-1-ylethanone.
| Compound Name | 1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 70761260 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-[(4aR,7aS)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCCC1)N1CCN(c2ncccn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H25N5O3S/c23-16(11-20-7-2-1-3-8-20)21-9-10-22(17-18-5-4-6-19-17)15-13-26(24,25)12-14(15)21/h4-6,14-15H,1-3,7-13H2/t14-,15+/m0/s1 |
| InChIKey | WJMOBAWMCRBZRJ-LSDHHAIUSA-N |
| XLogP | -0.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |