C18H26N4O3S — CID 164636331
[(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cycloheptylmethanone (PubChem CID 164636331) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is [(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cycloheptylmethanone.
| Compound Name | [(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cycloheptylmethanone |
|---|---|
| PubChem CID | 164636331 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cycloheptylmethanone |
| SMILES | O=C(C1CCCCCC1)N1CCN(c2ncccn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H26N4O3S/c23-17(14-6-3-1-2-4-7-14)21-10-11-22(18-19-8-5-9-20-18)16-13-26(24,25)12-15(16)21/h5,8-9,14-16H,1-4,6-7,10-13H2/t15-,16+/m1/s1 |
| InChIKey | CNLOLGLIGHMQJO-CVEARBPZSA-N |
| XLogP | 1.26 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |