C16H20N4O5S — CID 70776745
5-[(4aR,7aS)-1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1H-pyrimidin-6-one (PubChem CID 70776745) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is 5-[(4aR,7aS)-1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[(4aR,7aS)-1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 70776745 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 5-[(4aR,7aS)-1-(cyclobutanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1H-pyrimidin-6-one |
| SMILES | O=C(C1CCC1)N1CCN(C(=O)c2cnc[nH]c2=O)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H20N4O5S/c21-14-11(6-17-9-18-14)16(23)20-5-4-19(15(22)10-2-1-3-10)12-7-26(24,25)8-13(12)20/h6,9-10,12-13H,1-5,7-8H2,(H,17,18,21)/t12-,13+/m1/s1 |
| InChIKey | WXCZCIUZZSNVQZ-OLZOCXBDSA-N |
| XLogP | -0.98 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |