C16H21N3O5S — CID 133124782
3-[(4aR,7aS)-4-(2-methylpropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 133124782) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-[(4aR,7aS)-4-(2-methylpropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 3-[(4aR,7aS)-4-(2-methylpropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133124782 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[(4aR,7aS)-4-(2-methylpropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | CC(C)C(=O)N1CCN(C(=O)c2ccc[nH]c2=O)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H21N3O5S/c1-10(2)15(21)18-6-7-19(13-9-25(23,24)8-12(13)18)16(22)11-4-3-5-17-14(11)20/h3-5,10,12-13H,6-9H2,1-2H3,(H,17,20)/t12-,13+/m0/s1 |
| InChIKey | QLUDHACPWGEDCA-QWHCGFSZSA-N |
| XLogP | -0.52 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |