C19H24N4O3S — CID 70728207
[(4aS,7aR)-1-(1H-benzimidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone (PubChem CID 70728207) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is [(4aS,7aR)-1-(1H-benzimidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone.
| Compound Name | [(4aS,7aR)-1-(1H-benzimidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 70728207 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [(4aS,7aR)-1-(1H-benzimidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCN(Cc2nc3ccccc3[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C19H24N4O3S/c24-19(13-4-3-5-13)23-9-8-22(16-11-27(25,26)12-17(16)23)10-18-20-14-6-1-2-7-15(14)21-18/h1-2,6-7,13,16-17H,3-5,8-12H2,(H,20,21)/t16-,17+/m0/s1 |
| InChIKey | JURQBGDJFLXLQQ-DLBZAZTESA-N |
| XLogP | 1.17 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |