C19H17N3O3S — CID 155256392
N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256392) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256392 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | Cc1ccccc1-c1cccc2c1N/C(=N/Cc1ccco1)NS2(=O)=O |
| InChI | InChI=1S/C19H17N3O3S/c1-13-6-2-3-8-15(13)16-9-4-10-17-18(16)21-19(22-26(17,23)24)20-12-14-7-5-11-25-14/h2-11H,12H2,1H3,(H2,20,21,22) |
| InChIKey | DGMIYYLMKISUKK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|