C14H16N4O3S — CID 136924410
3-(furan-2-ylmethylimino)-N,N-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-amine (PubChem CID 136924410) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 3-(furan-2-ylmethylimino)-N,N-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-amine.
| Compound Name | 3-(furan-2-ylmethylimino)-N,N-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-amine |
|---|---|
| PubChem CID | 136924410 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-(furan-2-ylmethylimino)-N,N-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-amine |
| SMILES | CN(C)c1ccc2c(c1)S(=O)(=O)N/C(=N/Cc1ccco1)N2 |
| InChI | InChI=1S/C14H16N4O3S/c1-18(2)10-5-6-12-13(8-10)22(19,20)17-14(16-12)15-9-11-4-3-7-21-11/h3-8H,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | QDVXMBSGEMHIHO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|