C15H13FN2O3S — CID 135735953
5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135735953) has the molecular formula C15H13FN2O3S and a molecular weight of 320.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135735953 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(F)cc2)S(=O)(=O)N/C1=N\Cc1ccco1 |
| InChI | InChI=1S/C15H13FN2O3S/c1-10-14(11-4-6-12(16)7-5-11)22(19,20)18-15(10)17-9-13-3-2-8-21-13/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | GHGQAEAARWYAQM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|