About 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine
5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135735953) has the molecular formula C15H13FN2O3S
and a molecular weight of 320.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| PubChem CID | 135735953 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(F)cc2)S(=O)(=O)N/C1=N\Cc1ccco1 |
| InChI | InChI=1S/C15H13FN2O3S/c1-10-14(11-4-6-12(16)7-5-11)22(19,20)18-15(10)17-9-13-3-2-8-21-13/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | GHGQAEAARWYAQM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine?
The IUPAC name of 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (CID 135735953) is 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
What is the SMILES notation for 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine?
The canonical SMILES for 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine is CC1=C(c2ccc(F)cc2)S(=O)(=O)N/C1=N\Cc1ccco1.
What is the InChIKey of 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine?
The InChIKey is GHGQAEAARWYAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN2O3S/c1-10-14(11-4-6-12(16)7-5-11)22(19,20)18-15(10)17-9-13-3-2-8-21-13/h2-8H,9H2,1H3,(H,17,18).
What are the key properties of 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine?
5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine has a molecular weight of 320.35 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine is sourced from PubChem (CID 135735953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).