C18H17FN2O2S — CID 135735929
5-(4-fluorophenyl)-4-methyl-N-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135735929) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-methyl-N-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | 5-(4-fluorophenyl)-4-methyl-N-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135735929 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 5-(4-fluorophenyl)-4-methyl-N-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(F)cc2)S(=O)(=O)N/C1=N\Cc1ccc(C)cc1 |
| InChI | InChI=1S/C18H17FN2O2S/c1-12-3-5-14(6-4-12)11-20-18-13(2)17(24(22,23)21-18)15-7-9-16(19)10-8-15/h3-10H,11H2,1-2H3,(H,20,21) |
| InChIKey | OISNQNKIKHBUPO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|