About 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine
4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine (PubChem CID 135810143) has the molecular formula C16H16N2O2S2
and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine.
Molecular Properties
| Compound Name | 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine |
| PubChem CID | 135810143 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccccc2)S(=O)(=O)N/C1=N\CCc1cccs1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-12-15(13-6-3-2-4-7-13)22(19,20)18-16(12)17-10-9-14-8-5-11-21-14/h2-8,11H,9-10H2,1H3,(H,17,18) |
| InChIKey | YUFNFTZPTAWYFA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine?
The IUPAC name of 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine (CID 135810143) is 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine.
What is the SMILES notation for 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine?
The canonical SMILES for 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine is CC1=C(c2ccccc2)S(=O)(=O)N/C1=N\CCc1cccs1.
What is the InChIKey of 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine?
The InChIKey is YUFNFTZPTAWYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S2/c1-12-15(13-6-3-2-4-7-13)22(19,20)18-16(12)17-10-9-14-8-5-11-21-14/h2-8,11H,9-10H2,1H3,(H,17,18).
What are the key properties of 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine?
4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine has a molecular weight of 332.45 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,1-dioxo-5-phenyl-N-(2-thiophen-2-ylethyl)-1,2-thiazol-3-imine is sourced from PubChem (CID 135810143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).