C20H22N2O3S — CID 136800512
5-(4-methoxyphenyl)-4-methyl-1,1-dioxo-N-[(2S)-2-phenylpropyl]-1,2-thiazol-3-imine (PubChem CID 136800512) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-methyl-1,1-dioxo-N-[(2S)-2-phenylpropyl]-1,2-thiazol-3-imine.
| Compound Name | 5-(4-methoxyphenyl)-4-methyl-1,1-dioxo-N-[(2S)-2-phenylpropyl]-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 136800512 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-methyl-1,1-dioxo-N-[(2S)-2-phenylpropyl]-1,2-thiazol-3-imine |
| SMILES | COc1ccc(C2=C(C)/C(=N/C[C@@H](C)c3ccccc3)NS2(=O)=O)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-14(16-7-5-4-6-8-16)13-21-20-15(2)19(26(23,24)22-20)17-9-11-18(25-3)12-10-17/h4-12,14H,13H2,1-3H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | PVJDMKLDYAPPDW-CQSZACIVSA-N |
| XLogP | 3.56 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|