C17H19N3O3S3 — CID 136820349
(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]propanamide (PubChem CID 136820349) has the molecular formula C17H19N3O3S3 and a molecular weight of 409.56 g/mol. Its IUPAC name is (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]propanamide.
| Compound Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 136820349 |
| Molecular Formula | C17H19N3O3S3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]propanamide |
| SMILES | C[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCCSCc1cccs1 |
| InChI | InChI=1S/C17H19N3O3S3/c1-12(17(21)18-8-10-24-11-13-5-4-9-25-13)19-16-14-6-2-3-7-15(14)26(22,23)20-16/h2-7,9,12H,8,10-11H2,1H3,(H,18,21)(H,19,20)/t12-/m1/s1 |
| InChIKey | HTSDMWKHQYXUFM-GFCCVEGCSA-N |
| XLogP | 2.22 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|