C14H14N2O3S2 — CID 137249028
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-thiophen-2-ylpropan-1-ol (PubChem CID 137249028) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-thiophen-2-ylpropan-1-ol.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 137249028 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-thiophen-2-ylpropan-1-ol |
| SMILES | O=S1(=O)N/C(=N\C(CCO)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C14H14N2O3S2/c17-8-7-11(12-5-3-9-20-12)15-14-10-4-1-2-6-13(10)21(18,19)16-14/h1-6,9,11,17H,7-8H2,(H,15,16) |
| InChIKey | XEUQWIMZKVTBOY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|