C16H12N2O — CID 135983993
N-(furan-2-ylmethyl)-1H-benzo[cd]indol-2-imine (PubChem CID 135983993) has the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1H-benzo[cd]indol-2-imine.
| Compound Name | N-(furan-2-ylmethyl)-1H-benzo[cd]indol-2-imine |
|---|---|
| PubChem CID | 135983993 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-1H-benzo[cd]indol-2-imine |
| SMILES | c1coc(C/N=C2\Nc3cccc4cccc2c34)c1 |
| InChI | InChI=1S/C16H12N2O/c1-4-11-5-2-8-14-15(11)13(7-1)16(18-14)17-10-12-6-3-9-19-12/h1-9H,10H2,(H,17,18) |
| InChIKey | IRSHGLMTRIVHQA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|