C21H20N4O3 — CID 175905803
2-(1,3-benzodioxol-5-ylmethyl)-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine (PubChem CID 175905803) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine |
|---|---|
| PubChem CID | 175905803 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine |
| SMILES | NC1(Cc2ccc3c(c2)OCO3)N/C(=N/Cc2ccco2)c2ccccc2N1 |
| InChI | InChI=1S/C21H20N4O3/c22-21(11-14-7-8-18-19(10-14)28-13-27-18)24-17-6-2-1-5-16(17)20(25-21)23-12-15-4-3-9-26-15/h1-10,24H,11-13,22H2,(H,23,25) |
| InChIKey | AEFNOWKLCKDZIZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|