C12H16N2O2 — CID 122446387
(3S)-3-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-amine (PubChem CID 122446387) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-amine.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 122446387 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-amine |
| SMILES | N[C@@]1(Cc2ccc3c(c2)OCO3)CCNC1 |
| InChI | InChI=1S/C12H16N2O2/c13-12(3-4-14-7-12)6-9-1-2-10-11(5-9)16-8-15-10/h1-2,5,14H,3-4,6-8,13H2/t12-/m1/s1 |
| InChIKey | WBTOXCZRUCMLJJ-GFCCVEGCSA-N |
| XLogP | 0.65 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |