C14H18N2O2 — CID 82537950
2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[4.4]nonane (PubChem CID 82537950) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82537950 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[4.4]nonane |
| SMILES | c1cc2c(cc1N1CCC3(CCNC3)C1)OCO2 |
| InChI | InChI=1S/C14H18N2O2/c1-2-12-13(18-10-17-12)7-11(1)16-6-4-14(9-16)3-5-15-8-14/h1-2,7,15H,3-6,8-10H2 |
| InChIKey | IFEXZDFDRPYPJA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|