C13H17ClN2 — CID 96706336
(5S)-2-(2-chlorophenyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 96706336) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is (5S)-2-(2-chlorophenyl)-2,7-diazaspiro[4.4]nonane.
| Compound Name | (5S)-2-(2-chlorophenyl)-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 96706336 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (5S)-2-(2-chlorophenyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | Clc1ccccc1N1CC[C@]2(CCNC2)C1 |
| InChI | InChI=1S/C13H17ClN2/c14-11-3-1-2-4-12(11)16-8-6-13(10-16)5-7-15-9-13/h1-4,15H,5-10H2/t13-/m0/s1 |
| InChIKey | XFGGWQFGZJYQBL-ZDUSSCGKSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |