C14H17ClN2O — CID 82038205
(2-chlorophenyl)-(2,7-diazaspiro[4.4]nonan-2-yl)methanone (PubChem CID 82038205) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (2-chlorophenyl)-(2,7-diazaspiro[4.4]nonan-2-yl)methanone.
| Compound Name | (2-chlorophenyl)-(2,7-diazaspiro[4.4]nonan-2-yl)methanone |
|---|---|
| PubChem CID | 82038205 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2-chlorophenyl)-(2,7-diazaspiro[4.4]nonan-2-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C14H17ClN2O/c15-12-4-2-1-3-11(12)13(18)17-8-6-14(10-17)5-7-16-9-14/h1-4,16H,5-10H2 |
| InChIKey | LEQQFEMFAKZHCQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |