C18H21N3O2 — CID 56752764
3-(2,9-diazaspiro[4.5]decane-2-carbonyl)-1H-quinolin-2-one (PubChem CID 56752764) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-(2,9-diazaspiro[4.5]decane-2-carbonyl)-1H-quinolin-2-one.
| Compound Name | 3-(2,9-diazaspiro[4.5]decane-2-carbonyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56752764 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-(2,9-diazaspiro[4.5]decane-2-carbonyl)-1H-quinolin-2-one |
| SMILES | O=C(c1cc2ccccc2[nH]c1=O)N1CCC2(CCCNC2)C1 |
| InChI | InChI=1S/C18H21N3O2/c22-16-14(10-13-4-1-2-5-15(13)20-16)17(23)21-9-7-18(12-21)6-3-8-19-11-18/h1-2,4-5,10,19H,3,6-9,11-12H2,(H,20,22) |
| InChIKey | VPTJJMDWWCLDRS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |